C25H31BrN10O4 — CID 10305013
4-[[4-[[4-(2-bromoprop-2-enoylamino)-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carbonyl]amino]-N-[3-(diaminomethylideneamino)propyl]-1-methylpyrrole-2-carboxamide (PubChem CID 10305013) has the molecular formula C25H31BrN10O4 and a molecular weight of 615.49 g/mol. Its IUPAC name is 4-[[4-[[4-(2-bromoprop-2-enoylamino)-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carbonyl]amino]-N-[3-(diaminomethylideneamino)propyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[[4-[[4-(2-bromoprop-2-enoylamino)-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carbonyl]amino]-N-[3-(diaminomethylideneamino)propyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 10305013 |
| Molecular Formula | C25H31BrN10O4 |
| Molecular Weight | 615.49 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | 4-[[4-[[4-(2-bromoprop-2-enoylamino)-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carbonyl]amino]-N-[3-(diaminomethylideneamino)propyl]-1-methylpyrrole-2-carboxamide |
| SMILES | C=C(Br)C(=O)Nc1cc(C(=O)Nc2cc(C(=O)Nc3cc(C(=O)NCCCN=C(N)N)n(C)c3)n(C)c2)n(C)c1 |
| InChI | InChI=1S/C25H31BrN10O4/c1-14(26)21(37)31-15-9-19(35(3)11-15)23(39)33-17-10-20(36(4)13-17)24(40)32-16-8-18(34(2)12-16)22(38)29-6-5-7-30-25(27)28/h8-13H,1,5-7H2,2-4H3,(H,29,38)(H,31,37)(H,32,40)(H,33,39)(H4,27,28,30) |
| InChIKey | HUKJGMULFLBABC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 195.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|