C32H34F2N6O4 — CID 58357283
2-[4-[4-[2-[4-[2-[4-[2-(2,4-difluorophenyl)-2-oxoethyl]-1-methylpyrrol-2-yl]-2-oxoethyl]-1-methylpyrrol-2-yl]-2-oxoethyl]-1-methylpyrrol-2-yl]-4-oxobutyl]guanidine (PubChem CID 58357283) has the molecular formula C32H34F2N6O4 and a molecular weight of 604.66 g/mol. Its IUPAC name is 2-[4-[4-[2-[4-[2-[4-[2-(2,4-difluorophenyl)-2-oxoethyl]-1-methylpyrrol-2-yl]-2-oxoethyl]-1-methylpyrrol-2-yl]-2-oxoethyl]-1-methylpyrrol-2-yl]-4-oxobutyl]guanidine.
| Compound Name | 2-[4-[4-[2-[4-[2-[4-[2-(2,4-difluorophenyl)-2-oxoethyl]-1-methylpyrrol-2-yl]-2-oxoethyl]-1-methylpyrrol-2-yl]-2-oxoethyl]-1-methylpyrrol-2-yl]-4-oxobutyl]guanidine |
|---|---|
| PubChem CID | 58357283 |
| Molecular Formula | C32H34F2N6O4 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 2-[4-[4-[2-[4-[2-[4-[2-(2,4-difluorophenyl)-2-oxoethyl]-1-methylpyrrol-2-yl]-2-oxoethyl]-1-methylpyrrol-2-yl]-2-oxoethyl]-1-methylpyrrol-2-yl]-4-oxobutyl]guanidine |
| SMILES | Cn1cc(CC(=O)c2cc(CC(=O)c3cc(CC(=O)c4ccc(F)cc4F)cn3C)cn2C)cc1C(=O)CCCN=C(N)N |
| InChI | InChI=1S/C32H34F2N6O4/c1-38-17-20(9-25(38)28(41)5-4-8-37-32(35)36)13-30(43)27-11-21(18-40(27)3)14-31(44)26-10-19(16-39(26)2)12-29(42)23-7-6-22(33)15-24(23)34/h6-7,9-11,15-18H,4-5,8,12-14H2,1-3H3,(H4,35,36,37) |
| InChIKey | CEFJIVSULSXBAX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 147.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|