C20H20F2O5 — CID 141003424
1-(2,4-difluorophenyl)-5-(3,4,5-trimethoxyphenyl)pentane-1,5-dione (PubChem CID 141003424) has the molecular formula C20H20F2O5 and a molecular weight of 378.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-5-(3,4,5-trimethoxyphenyl)pentane-1,5-dione.
| Compound Name | 1-(2,4-difluorophenyl)-5-(3,4,5-trimethoxyphenyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 141003424 |
| Molecular Formula | C20H20F2O5 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-5-(3,4,5-trimethoxyphenyl)pentane-1,5-dione |
| SMILES | COc1cc(C(=O)CCCC(=O)c2ccc(F)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C20H20F2O5/c1-25-18-9-12(10-19(26-2)20(18)27-3)16(23)5-4-6-17(24)14-8-7-13(21)11-15(14)22/h7-11H,4-6H2,1-3H3 |
| InChIKey | JQYNFAWQHIVLBN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |