C15H18O4 — CID 115801613
1-(3,4,5-trimethoxyphenyl)hex-4-yn-1-one (PubChem CID 115801613) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)hex-4-yn-1-one.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)hex-4-yn-1-one |
|---|---|
| PubChem CID | 115801613 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)hex-4-yn-1-one |
| SMILES | CC#CCCC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H18O4/c1-5-6-7-8-12(16)11-9-13(17-2)15(19-4)14(10-11)18-3/h9-10H,7-8H2,1-4H3 |
| InChIKey | QTQSGLOYVIXWFP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|