C17H26O4 — CID 114966527
1-(3,4,5-trimethoxyphenyl)octan-1-one (PubChem CID 114966527) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)octan-1-one.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)octan-1-one |
|---|---|
| PubChem CID | 114966527 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)octan-1-one |
| SMILES | CCCCCCCC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H26O4/c1-5-6-7-8-9-10-14(18)13-11-15(19-2)17(21-4)16(12-13)20-3/h11-12H,5-10H2,1-4H3 |
| InChIKey | GUVQKGZKOXUSPQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|