C17H26O5 — CID 14873632
1-(6-hydroxy-2,3,4-trimethoxyphenyl)octan-1-one (PubChem CID 14873632) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-(6-hydroxy-2,3,4-trimethoxyphenyl)octan-1-one.
| Compound Name | 1-(6-hydroxy-2,3,4-trimethoxyphenyl)octan-1-one |
|---|---|
| PubChem CID | 14873632 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-(6-hydroxy-2,3,4-trimethoxyphenyl)octan-1-one |
| SMILES | CCCCCCCC(=O)c1c(O)cc(OC)c(OC)c1OC |
| InChI | InChI=1S/C17H26O5/c1-5-6-7-8-9-10-12(18)15-13(19)11-14(20-2)16(21-3)17(15)22-4/h11,19H,5-10H2,1-4H3 |
| InChIKey | UZIAIFCNLDYZEU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|