C18H28O3 — CID 114966448
1-(2,6-dimethoxyphenyl)decan-1-one (PubChem CID 114966448) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)decan-1-one.
| Compound Name | 1-(2,6-dimethoxyphenyl)decan-1-one |
|---|---|
| PubChem CID | 114966448 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)decan-1-one |
| SMILES | CCCCCCCCCC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C18H28O3/c1-4-5-6-7-8-9-10-12-15(19)18-16(20-2)13-11-14-17(18)21-3/h11,13-14H,4-10,12H2,1-3H3 |
| InChIKey | DUKDPCJOTNRAGG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|