C13H16Cl2O — CID 114966663
1-(2,6-dichlorophenyl)heptan-1-one (PubChem CID 114966663) has the molecular formula C13H16Cl2O and a molecular weight of 259.18 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)heptan-1-one.
| Compound Name | 1-(2,6-dichlorophenyl)heptan-1-one |
|---|---|
| PubChem CID | 114966663 |
| Molecular Formula | C13H16Cl2O |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-(2,6-dichlorophenyl)heptan-1-one |
| SMILES | CCCCCCC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2O/c1-2-3-4-5-9-12(16)13-10(14)7-6-8-11(13)15/h6-8H,2-5,9H2,1H3 |
| InChIKey | NRTMOUMRDLUVBE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|