C11H12Cl2LiOP — CID 141023129
lithium [5-(2,6-dichlorophenyl)-5-oxopentyl]phosphanide (PubChem CID 141023129) has the molecular formula C11H12Cl2LiOP and a molecular weight of 269.04 g/mol. Its IUPAC name is lithium [5-(2,6-dichlorophenyl)-5-oxopentyl]phosphanide.
| Compound Name | lithium [5-(2,6-dichlorophenyl)-5-oxopentyl]phosphanide |
|---|---|
| PubChem CID | 141023129 |
| Molecular Formula | C11H12Cl2LiOP |
| Molecular Weight | 269.04 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | lithium [5-(2,6-dichlorophenyl)-5-oxopentyl]phosphanide |
| SMILES | O=C(CCCC[PH-])c1c(Cl)cccc1Cl.[Li+] |
| InChI | InChI=1S/C11H12Cl2OP.Li/c12-8-4-3-5-9(13)11(8)10(14)6-1-2-7-15;/h3-5,15H,1-2,6-7H2;/q-1;+1 |
| InChIKey | ZSGQNZQSTATOBQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.04 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|