C17H22Cl2O3 — CID 24727962
1-(2,6-dichlorophenyl)-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-1-one (PubChem CID 24727962) has the molecular formula C17H22Cl2O3 and a molecular weight of 345.27 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-1-one.
| Compound Name | 1-(2,6-dichlorophenyl)-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 24727962 |
| Molecular Formula | C17H22Cl2O3 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-1-one |
| SMILES | CC1(C)COC(CCCCC(=O)c2c(Cl)cccc2Cl)OC1 |
| InChI | InChI=1S/C17H22Cl2O3/c1-17(2)10-21-15(22-11-17)9-4-3-8-14(20)16-12(18)6-5-7-13(16)19/h5-7,15H,3-4,8-11H2,1-2H3 |
| InChIKey | HKVDMSDGJIMSLP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|