4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid

C10H18O4 — CID 14588439

IUPAC4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid
SMILESCC1(C)COC(CCCC(=O)O)OC1
InChIInChI=1S/C10H18O4/c1-10(2)6-13-9(14-7-10)5-3-4-8(11)12/h9H,3-7H2,1-2H3,(H,11,12)
InChIKeyMZSBLWGXXRVZHY-UHFFFAOYSA-N
MW202.25 g/mol
LogP1.64
Rot. Bonds4

About 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid

4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid (PubChem CID 14588439) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid.

Molecular Properties

Compound Name4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid
PubChem CID14588439
Molecular FormulaC10H18O4
Molecular Weight202.25 g/mol
Exact Mass202.12
IUPAC Name4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid
SMILESCC1(C)COC(CCCC(=O)O)OC1
InChIInChI=1S/C10H18O4/c1-10(2)6-13-9(14-7-10)5-3-4-8(11)12/h9H,3-7H2,1-2H3,(H,11,12)
InChIKeyMZSBLWGXXRVZHY-UHFFFAOYSA-N
XLogP1.64
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.25
LogP ≤ 51.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid?
The IUPAC name of 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid (CID 14588439) is 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid.
What is the SMILES notation for 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid?
The canonical SMILES for 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid is CC1(C)COC(CCCC(=O)O)OC1.
What is the InChIKey of 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid?
The InChIKey is MZSBLWGXXRVZHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-10(2)6-13-9(14-7-10)5-3-4-8(11)12/h9H,3-7H2,1-2H3,(H,11,12).
What are the key properties of 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid?
4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid has a molecular weight of 202.25 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid is sourced from PubChem (CID 14588439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).