C10H18O4 — CID 14588439
4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid (PubChem CID 14588439) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid.
| Compound Name | 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid |
|---|---|
| PubChem CID | 14588439 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 4-(5,5-dimethyl-1,3-dioxan-2-yl)butanoic acid |
| SMILES | CC1(C)COC(CCCC(=O)O)OC1 |
| InChI | InChI=1S/C10H18O4/c1-10(2)6-13-9(14-7-10)5-3-4-8(11)12/h9H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | MZSBLWGXXRVZHY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |