C16H29NO3 — CID 91798406
N-cyclohexyl-4-(5,5-dimethyl-1,3-dioxan-2-yl)butanamide (PubChem CID 91798406) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is N-cyclohexyl-4-(5,5-dimethyl-1,3-dioxan-2-yl)butanamide.
| Compound Name | N-cyclohexyl-4-(5,5-dimethyl-1,3-dioxan-2-yl)butanamide |
|---|---|
| PubChem CID | 91798406 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N-cyclohexyl-4-(5,5-dimethyl-1,3-dioxan-2-yl)butanamide |
| SMILES | CC1(C)COC(CCCC(=O)NC2CCCCC2)OC1 |
| InChI | InChI=1S/C16H29NO3/c1-16(2)11-19-15(20-12-16)10-6-9-14(18)17-13-7-4-3-5-8-13/h13,15H,3-12H2,1-2H3,(H,17,18) |
| InChIKey | PLWPLJICAIACTM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |