C12H23NO4 — CID 170872491
3-amino-6-(5,5-dimethyl-1,3-dioxan-2-yl)hexanoic acid (PubChem CID 170872491) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-amino-6-(5,5-dimethyl-1,3-dioxan-2-yl)hexanoic acid.
| Compound Name | 3-amino-6-(5,5-dimethyl-1,3-dioxan-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 170872491 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-amino-6-(5,5-dimethyl-1,3-dioxan-2-yl)hexanoic acid |
| SMILES | CC1(C)COC(CCCC(N)CC(=O)O)OC1 |
| InChI | InChI=1S/C12H23NO4/c1-12(2)7-16-11(17-8-12)5-3-4-9(13)6-10(14)15/h9,11H,3-8,13H2,1-2H3,(H,14,15) |
| InChIKey | HMXQTENPKBKNOA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |