C11H11Cl3LiOP — CID 141022914
lithium [5-oxo-5-(2,4,6-trichlorophenyl)pentyl]phosphanide (PubChem CID 141022914) has the molecular formula C11H11Cl3LiOP and a molecular weight of 303.48 g/mol. Its IUPAC name is lithium [5-oxo-5-(2,4,6-trichlorophenyl)pentyl]phosphanide.
| Compound Name | lithium [5-oxo-5-(2,4,6-trichlorophenyl)pentyl]phosphanide |
|---|---|
| PubChem CID | 141022914 |
| Molecular Formula | C11H11Cl3LiOP |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | lithium [5-oxo-5-(2,4,6-trichlorophenyl)pentyl]phosphanide |
| SMILES | O=C(CCCC[PH-])c1c(Cl)cc(Cl)cc1Cl.[Li+] |
| InChI | InChI=1S/C11H11Cl3OP.Li/c12-7-5-8(13)11(9(14)6-7)10(15)3-1-2-4-16;/h5-6,16H,1-4H2;/q-1;+1 |
| InChIKey | UFGWEMUFFREPAO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|