C7H2Cl3FO — CID 154123611
2,4,6-trichlorobenzoyl fluoride (PubChem CID 154123611) has the molecular formula C7H2Cl3FO and a molecular weight of 227.45 g/mol. Its IUPAC name is 2,4,6-trichlorobenzoyl fluoride.
| Compound Name | 2,4,6-trichlorobenzoyl fluoride |
|---|---|
| PubChem CID | 154123611 |
| Molecular Formula | C7H2Cl3FO |
| Molecular Weight | 227.45 g/mol |
| Exact Mass | 225.92 |
| IUPAC Name | 2,4,6-trichlorobenzoyl fluoride |
| SMILES | O=C(F)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H2Cl3FO/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H |
| InChIKey | VAKKMDVCJKMUJW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|