C8H2Cl2Na2O4 — CID 101143275
disodium;3,5-dichlorophthalate (PubChem CID 101143275) has the molecular formula C8H2Cl2Na2O4 and a molecular weight of 278.99 g/mol. Its IUPAC name is disodium;3,5-dichlorophthalate.
| Compound Name | disodium;3,5-dichlorophthalate |
|---|---|
| PubChem CID | 101143275 |
| Molecular Formula | C8H2Cl2Na2O4 |
| Molecular Weight | 278.99 g/mol |
| Exact Mass | 277.91 |
| IUPAC Name | disodium;3,5-dichlorophthalate |
| SMILES | O=C([O-])c1cc(Cl)cc(Cl)c1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H4Cl2O4.2Na/c9-3-1-4(7(11)12)6(8(13)14)5(10)2-3;;/h1-2H,(H,11,12)(H,13,14);;/q;2*+1/p-2 |
| InChIKey | KILNGNWVEVXWBM-UHFFFAOYSA-L |
| XLogP | -6.27 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.99 |
| LogP ≤ 5 | -6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |