C8H9ClF2N2O4 — CID 139754124
diazanium;5-chloro-2,4-difluorobenzene-1,3-dicarboxylate (PubChem CID 139754124) has the molecular formula C8H9ClF2N2O4 and a molecular weight of 270.62 g/mol. Its IUPAC name is diazanium;5-chloro-2,4-difluorobenzene-1,3-dicarboxylate.
| Compound Name | diazanium;5-chloro-2,4-difluorobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 139754124 |
| Molecular Formula | C8H9ClF2N2O4 |
| Molecular Weight | 270.62 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | diazanium;5-chloro-2,4-difluorobenzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1cc(Cl)c(F)c(C(=O)[O-])c1F.[NH4+].[NH4+] |
| InChI | InChI=1S/C8H3ClF2O4.2H3N/c9-3-1-2(7(12)13)5(10)4(6(3)11)8(14)15;;/h1H,(H,12,13)(H,14,15);2*1H3 |
| InChIKey | NACMHEZSMGNLHY-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 153.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.62 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|