C7HF4NaO2 — CID 23675288
sodium 2,3,4,5-tetrafluorobenzoate (PubChem CID 23675288) has the molecular formula C7HF4NaO2 and a molecular weight of 216.06 g/mol. Its IUPAC name is sodium 2,3,4,5-tetrafluorobenzoate.
| Compound Name | sodium 2,3,4,5-tetrafluorobenzoate |
|---|---|
| PubChem CID | 23675288 |
| Molecular Formula | C7HF4NaO2 |
| Molecular Weight | 216.06 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | sodium 2,3,4,5-tetrafluorobenzoate |
| SMILES | O=C([O-])c1cc(F)c(F)c(F)c1F.[Na+] |
| InChI | InChI=1S/C7H2F4O2.Na/c8-3-1-2(7(12)13)4(9)6(11)5(3)10;/h1H,(H,12,13);/q;+1/p-1 |
| InChIKey | PVMKPXIEIWFYDX-UHFFFAOYSA-M |
| XLogP | -2.39 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.06 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|