C10H5F4O3- — CID 164845157
(Z)-3-methoxy-3-oxo-1-(2,3,4,5-tetrafluorophenyl)prop-1-en-1-olate (PubChem CID 164845157) has the molecular formula C10H5F4O3- and a molecular weight of 249.14 g/mol. Its IUPAC name is (Z)-3-methoxy-3-oxo-1-(2,3,4,5-tetrafluorophenyl)prop-1-en-1-olate.
| Compound Name | (Z)-3-methoxy-3-oxo-1-(2,3,4,5-tetrafluorophenyl)prop-1-en-1-olate |
|---|---|
| PubChem CID | 164845157 |
| Molecular Formula | C10H5F4O3- |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | (Z)-3-methoxy-3-oxo-1-(2,3,4,5-tetrafluorophenyl)prop-1-en-1-olate |
| SMILES | COC(=O)/C=C(\[O-])c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H6F4O3/c1-17-7(16)3-6(15)4-2-5(11)9(13)10(14)8(4)12/h2-3,15H,1H3/p-1/b6-3- |
| InChIKey | JBADRCKLRNLNBD-UTCJRWHESA-M |
| XLogP | 1.12 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|