C20H18F7NO4 — CID 167700409
methyl 4-(tert-butylamino)-2,3,5-trifluorobenzoate;methyl 2,3,4,5-tetrafluorobenzoate (PubChem CID 167700409) has the molecular formula C20H18F7NO4 and a molecular weight of 469.35 g/mol. Its IUPAC name is methyl 4-(tert-butylamino)-2,3,5-trifluorobenzoate;methyl 2,3,4,5-tetrafluorobenzoate.
| Compound Name | methyl 4-(tert-butylamino)-2,3,5-trifluorobenzoate;methyl 2,3,4,5-tetrafluorobenzoate |
|---|---|
| PubChem CID | 167700409 |
| Molecular Formula | C20H18F7NO4 |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | methyl 4-(tert-butylamino)-2,3,5-trifluorobenzoate;methyl 2,3,4,5-tetrafluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(F)c(F)c1F.COC(=O)c1cc(F)c(NC(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C12H14F3NO2.C8H4F4O2/c1-12(2,3)16-10-7(13)5-6(11(17)18-4)8(14)9(10)15;1-14-8(13)3-2-4(9)6(11)7(12)5(3)10/h5,16H,1-4H3;2H,1H3 |
| InChIKey | YHHSEUYNIAJHRQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|