C10H10F3NO4S — CID 12050375
methyl 5-(dimethylsulfamoyl)-2,3,4-trifluorobenzoate (PubChem CID 12050375) has the molecular formula C10H10F3NO4S and a molecular weight of 297.25 g/mol. Its IUPAC name is methyl 5-(dimethylsulfamoyl)-2,3,4-trifluorobenzoate.
| Compound Name | methyl 5-(dimethylsulfamoyl)-2,3,4-trifluorobenzoate |
|---|---|
| PubChem CID | 12050375 |
| Molecular Formula | C10H10F3NO4S |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | methyl 5-(dimethylsulfamoyl)-2,3,4-trifluorobenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N(C)C)c(F)c(F)c1F |
| InChI | InChI=1S/C10H10F3NO4S/c1-14(2)19(16,17)6-4-5(10(15)18-3)7(11)9(13)8(6)12/h4H,1-3H3 |
| InChIKey | MVXFOTPRMAXNGA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|