C14H14F3NO4S — CID 136561862
methyl 5-(2-azabicyclo[4.1.0]heptan-2-ylsulfonyl)-2,3,4-trifluorobenzoate (PubChem CID 136561862) has the molecular formula C14H14F3NO4S and a molecular weight of 349.33 g/mol. Its IUPAC name is methyl 5-(2-azabicyclo[4.1.0]heptan-2-ylsulfonyl)-2,3,4-trifluorobenzoate.
| Compound Name | methyl 5-(2-azabicyclo[4.1.0]heptan-2-ylsulfonyl)-2,3,4-trifluorobenzoate |
|---|---|
| PubChem CID | 136561862 |
| Molecular Formula | C14H14F3NO4S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | methyl 5-(2-azabicyclo[4.1.0]heptan-2-ylsulfonyl)-2,3,4-trifluorobenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCCC3CC32)c(F)c(F)c1F |
| InChI | InChI=1S/C14H14F3NO4S/c1-22-14(19)8-6-10(12(16)13(17)11(8)15)23(20,21)18-4-2-3-7-5-9(7)18/h6-7,9H,2-5H2,1H3 |
| InChIKey | YWAPLZVKHRNCHT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|