C16H19F2NO4S — CID 124792975
methyl (2S,3aR,7aR)-1-(3,5-difluorophenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 124792975) has the molecular formula C16H19F2NO4S and a molecular weight of 359.39 g/mol. Its IUPAC name is methyl (2S,3aR,7aR)-1-(3,5-difluorophenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aR,7aR)-1-(3,5-difluorophenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 124792975 |
| Molecular Formula | C16H19F2NO4S |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | methyl (2S,3aR,7aR)-1-(3,5-difluorophenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2CCCC[C@H]2N1S(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H19F2NO4S/c1-23-16(20)15-6-10-4-2-3-5-14(10)19(15)24(21,22)13-8-11(17)7-12(18)9-13/h7-10,14-15H,2-6H2,1H3/t10-,14-,15+/m1/s1 |
| InChIKey | VARVWCLJBTZUSU-KMUNFCNLSA-N |
| XLogP | 2.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |