C22H29FN2O5S — CID 124790792
methyl (2S,3aR,7aR)-1-[1-(2-fluorophenyl)sulfonylpiperidine-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 124790792) has the molecular formula C22H29FN2O5S and a molecular weight of 452.55 g/mol. Its IUPAC name is methyl (2S,3aR,7aR)-1-[1-(2-fluorophenyl)sulfonylpiperidine-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aR,7aR)-1-[1-(2-fluorophenyl)sulfonylpiperidine-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 124790792 |
| Molecular Formula | C22H29FN2O5S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | methyl (2S,3aR,7aR)-1-[1-(2-fluorophenyl)sulfonylpiperidine-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2CCCC[C@H]2N1C(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H29FN2O5S/c1-30-22(27)19-14-16-6-2-4-8-18(16)25(19)21(26)15-10-12-24(13-11-15)31(28,29)20-9-5-3-7-17(20)23/h3,5,7,9,15-16,18-19H,2,4,6,8,10-14H2,1H3/t16-,18-,19+/m1/s1 |
| InChIKey | NLYNCULRKPQSJD-QRQLOZEOSA-N |
| XLogP | 2.56 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |