C20H24FNO3 — CID 56807396
methyl 1-[2-(2-fluorophenyl)cyclopropanecarbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 56807396) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is methyl 1-[2-(2-fluorophenyl)cyclopropanecarbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-[2-(2-fluorophenyl)cyclopropanecarbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 56807396 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | methyl 1-[2-(2-fluorophenyl)cyclopropanecarbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1C(=O)C1CC1c1ccccc1F |
| InChI | InChI=1S/C20H24FNO3/c1-25-20(24)18-10-12-6-2-5-9-17(12)22(18)19(23)15-11-14(15)13-7-3-4-8-16(13)21/h3-4,7-8,12,14-15,17-18H,2,5-6,9-11H2,1H3 |
| InChIKey | DRSCSOFFIPGANH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |