C19H20FNO4S — CID 26097310
(4-methylphenyl) 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 26097310) has the molecular formula C19H20FNO4S and a molecular weight of 377.44 g/mol. Its IUPAC name is (4-methylphenyl) 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (4-methylphenyl) 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 26097310 |
| Molecular Formula | C19H20FNO4S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (4-methylphenyl) 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CCN(S(=O)(=O)c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C19H20FNO4S/c1-14-6-8-16(9-7-14)25-19(22)15-10-12-21(13-11-15)26(23,24)18-5-3-2-4-17(18)20/h2-9,15H,10-13H2,1H3 |
| InChIKey | IFBLDUZWWQMAGQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|