C22H23NO8S — CID 30279484
(4-methoxycarbonylphenyl) 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 30279484) has the molecular formula C22H23NO8S and a molecular weight of 461.49 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 30279484 |
| Molecular Formula | C22H23NO8S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | (4-methoxycarbonylphenyl) 1-(2-methoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)C2CCN(S(=O)(=O)c3ccccc3C(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C22H23NO8S/c1-29-20(24)15-7-9-17(10-8-15)31-21(25)16-11-13-23(14-12-16)32(27,28)19-6-4-3-5-18(19)22(26)30-2/h3-10,16H,11-14H2,1-2H3 |
| InChIKey | RAWYZAMLQJDKDO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|