C18H17Cl2NO4S — CID 2668352
phenyl 1-(2,3-dichlorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 2668352) has the molecular formula C18H17Cl2NO4S and a molecular weight of 414.31 g/mol. Its IUPAC name is phenyl 1-(2,3-dichlorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | phenyl 1-(2,3-dichlorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 2668352 |
| Molecular Formula | C18H17Cl2NO4S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | phenyl 1-(2,3-dichlorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | O=C(Oc1ccccc1)C1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C18H17Cl2NO4S/c19-15-7-4-8-16(17(15)20)26(23,24)21-11-9-13(10-12-21)18(22)25-14-5-2-1-3-6-14/h1-8,13H,9-12H2 |
| InChIKey | IJKZMWPPUYNGBC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|