C15H20Cl2N2O2S — CID 119987433
N-(cyclopropylmethyl)-1-(2,3-dichlorophenyl)sulfonylpiperidin-4-amine (PubChem CID 119987433) has the molecular formula C15H20Cl2N2O2S and a molecular weight of 363.31 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-(2,3-dichlorophenyl)sulfonylpiperidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-1-(2,3-dichlorophenyl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 119987433 |
| Molecular Formula | C15H20Cl2N2O2S |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-(cyclopropylmethyl)-1-(2,3-dichlorophenyl)sulfonylpiperidin-4-amine |
| SMILES | O=S(=O)(c1cccc(Cl)c1Cl)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C15H20Cl2N2O2S/c16-13-2-1-3-14(15(13)17)22(20,21)19-8-6-12(7-9-19)18-10-11-4-5-11/h1-3,11-12,18H,4-10H2 |
| InChIKey | GSUFXSBTKWWKGP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |