C16H21Cl2N3O2S — CID 119987396
2-chloro-6-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride (PubChem CID 119987396) has the molecular formula C16H21Cl2N3O2S and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-chloro-6-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride.
| Compound Name | 2-chloro-6-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 119987396 |
| Molecular Formula | C16H21Cl2N3O2S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-chloro-6-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1c(Cl)cccc1S(=O)(=O)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C16H20ClN3O2S.ClH/c17-15-2-1-3-16(14(15)10-18)23(21,22)20-8-6-13(7-9-20)19-11-12-4-5-12;/h1-3,12-13,19H,4-9,11H2;1H |
| InChIKey | USNHAAHDUSXFKG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |