C15H19ClN4O3S — CID 119971059
N-(2-aminoethyl)-1-(3-chloro-2-cyanophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 119971059) has the molecular formula C15H19ClN4O3S and a molecular weight of 370.86 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(3-chloro-2-cyanophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(3-chloro-2-cyanophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 119971059 |
| Molecular Formula | C15H19ClN4O3S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-(2-aminoethyl)-1-(3-chloro-2-cyanophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | N#Cc1c(Cl)cccc1S(=O)(=O)N1CCCC(C(=O)NCCN)C1 |
| InChI | InChI=1S/C15H19ClN4O3S/c16-13-4-1-5-14(12(13)9-18)24(22,23)20-8-2-3-11(10-20)15(21)19-7-6-17/h1,4-5,11H,2-3,6-8,10,17H2,(H,19,21) |
| InChIKey | QNPRGHOAVKNXRB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |