C14H19Cl2N3O3S — CID 119971159
N-(2-aminoethyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 119971159) has the molecular formula C14H19Cl2N3O3S and a molecular weight of 380.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 119971159 |
| Molecular Formula | C14H19Cl2N3O3S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-(2-aminoethyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(S(=O)(=O)c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C14H19Cl2N3O3S/c15-11-4-1-5-12(16)13(11)23(21,22)19-8-2-3-10(9-19)14(20)18-7-6-17/h1,4-5,10H,2-3,6-9,17H2,(H,18,20) |
| InChIKey | ONXZOKJYTLEPFU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |