C13H20N4O3S — CID 63253265
N-(2-aminoethyl)-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide (PubChem CID 63253265) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 63253265 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-(2-aminoethyl)-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(S(=O)(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C13H20N4O3S/c14-5-7-16-13(18)11-3-2-8-17(10-11)21(19,20)12-4-1-6-15-9-12/h1,4,6,9,11H,2-3,5,7-8,10,14H2,(H,16,18) |
| InChIKey | PYJFTLGLTLUTDQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |