C15H20F3N3O4S — CID 119971426
N-(2-aminoethyl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 119971426) has the molecular formula C15H20F3N3O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 119971426 |
| Molecular Formula | C15H20F3N3O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-(2-aminoethyl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(S(=O)(=O)c2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H20F3N3O4S/c16-15(17,18)25-12-4-1-5-13(9-12)26(23,24)21-8-2-3-11(10-21)14(22)20-7-6-19/h1,4-5,9,11H,2-3,6-8,10,19H2,(H,20,22) |
| InChIKey | FVKJZUCGVTXVLK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |