C18H23F3N2O5S — CID 46642629
N-(oxolan-2-ylmethyl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 46642629) has the molecular formula C18H23F3N2O5S and a molecular weight of 436.45 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46642629 |
| Molecular Formula | C18H23F3N2O5S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCC1CCCO1)C1CCN(S(=O)(=O)c2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H23F3N2O5S/c19-18(20,21)28-14-3-1-5-16(11-14)29(25,26)23-8-6-13(7-9-23)17(24)22-12-15-4-2-10-27-15/h1,3,5,11,13,15H,2,4,6-10,12H2,(H,22,24) |
| InChIKey | PHOHZVBKAAGFSU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |