C15H21ClN4O3S — CID 119971084
N-(2-aminoethyl)-1-(4-cyanophenyl)sulfonylpiperidine-3-carboxamide;hydrochloride (PubChem CID 119971084) has the molecular formula C15H21ClN4O3S and a molecular weight of 372.88 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(4-cyanophenyl)sulfonylpiperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-(4-cyanophenyl)sulfonylpiperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119971084 |
| Molecular Formula | C15H21ClN4O3S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-(2-aminoethyl)-1-(4-cyanophenyl)sulfonylpiperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.N#Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCN)C2)cc1 |
| InChI | InChI=1S/C15H20N4O3S.ClH/c16-7-8-18-15(20)13-2-1-9-19(11-13)23(21,22)14-5-3-12(10-17)4-6-14;/h3-6,13H,1-2,7-9,11,16H2,(H,18,20);1H |
| InChIKey | PMCMKIQYPPGSEQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |