C9H20N4O3S — CID 114810707
N-(2-aminoethyl)-1-(methylsulfamoyl)piperidine-3-carboxamide (PubChem CID 114810707) has the molecular formula C9H20N4O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(methylsulfamoyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(methylsulfamoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 114810707 |
| Molecular Formula | C9H20N4O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-(2-aminoethyl)-1-(methylsulfamoyl)piperidine-3-carboxamide |
| SMILES | CNS(=O)(=O)N1CCCC(C(=O)NCCN)C1 |
| InChI | InChI=1S/C9H20N4O3S/c1-11-17(15,16)13-6-2-3-8(7-13)9(14)12-5-4-10/h8,11H,2-7,10H2,1H3,(H,12,14) |
| InChIKey | IDTWBCJMUQUADI-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |