C12H24N4O4S — CID 63253133
N-(2-aminoethyl)-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide (PubChem CID 63253133) has the molecular formula C12H24N4O4S and a molecular weight of 320.42 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 63253133 |
| Molecular Formula | C12H24N4O4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-(2-aminoethyl)-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(S(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C12H24N4O4S/c13-3-4-14-12(17)11-2-1-5-16(10-11)21(18,19)15-6-8-20-9-7-15/h11H,1-10,13H2,(H,14,17) |
| InChIKey | LRPPCQVSZKUHPQ-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |