C16H29N3O4S — CID 22552797
N-cyclohexyl-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide (PubChem CID 22552797) has the molecular formula C16H29N3O4S and a molecular weight of 359.49 g/mol. Its IUPAC name is N-cyclohexyl-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-cyclohexyl-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 22552797 |
| Molecular Formula | C16H29N3O4S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N-cyclohexyl-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CCCN(S(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C16H29N3O4S/c20-16(17-15-6-2-1-3-7-15)14-5-4-8-19(13-14)24(21,22)18-9-11-23-12-10-18/h14-15H,1-13H2,(H,17,20) |
| InChIKey | PJQAPELFVZILMO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |