C25H40N4O4S — CID 92686982
(3S)-N-[3-(4-benzylpiperidin-1-yl)propyl]-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide (PubChem CID 92686982) has the molecular formula C25H40N4O4S and a molecular weight of 492.69 g/mol. Its IUPAC name is (3S)-N-[3-(4-benzylpiperidin-1-yl)propyl]-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(4-benzylpiperidin-1-yl)propyl]-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92686982 |
| Molecular Formula | C25H40N4O4S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | (3S)-N-[3-(4-benzylpiperidin-1-yl)propyl]-1-morpholin-4-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCC(Cc2ccccc2)CC1)[C@H]1CCCN(S(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C25H40N4O4S/c30-25(24-8-4-13-29(21-24)34(31,32)28-16-18-33-19-17-28)26-11-5-12-27-14-9-23(10-15-27)20-22-6-2-1-3-7-22/h1-3,6-7,23-24H,4-5,8-21H2,(H,26,30)/t24-/m0/s1 |
| InChIKey | CFPHGLMCBDMVLX-DEOSSOPVSA-N |
| XLogP | 1.74 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|