C20H38N4O3S — CID 98477781
(3S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-pyrrolidin-1-ylsulfonylpiperidine-3-carboxamide (PubChem CID 98477781) has the molecular formula C20H38N4O3S and a molecular weight of 414.62 g/mol. Its IUPAC name is (3S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-pyrrolidin-1-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-pyrrolidin-1-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 98477781 |
| Molecular Formula | C20H38N4O3S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | (3S)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-pyrrolidin-1-ylsulfonylpiperidine-3-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=O)[C@H]2CCCN(S(=O)(=O)N3CCCC3)C2)C1 |
| InChI | InChI=1S/C20H38N4O3S/c1-17-13-18(2)15-22(14-17)9-6-8-21-20(25)19-7-5-12-24(16-19)28(26,27)23-10-3-4-11-23/h17-19H,3-16H2,1-2H3,(H,21,25)/t17-,18-,19+/m1/s1 |
| InChIKey | GAKHQIWEWWRFSS-QRVBRYPASA-N |
| XLogP | 1.52 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|