C21H40N4O3S — CID 46273860
N-[3-(2-ethylpiperidin-1-yl)propyl]-1-piperidin-1-ylsulfonylpiperidine-3-carboxamide (PubChem CID 46273860) has the molecular formula C21H40N4O3S and a molecular weight of 428.64 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-1-piperidin-1-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-1-piperidin-1-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46273860 |
| Molecular Formula | C21H40N4O3S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-1-piperidin-1-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CCC1CCCCN1CCCNC(=O)C1CCCN(S(=O)(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C21H40N4O3S/c1-2-20-11-4-7-13-23(20)14-9-12-22-21(26)19-10-8-17-25(18-19)29(27,28)24-15-5-3-6-16-24/h19-20H,2-18H2,1H3,(H,22,26) |
| InChIKey | GASUHEQCZLYEHU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|