C18H35N3O3S — CID 124757090
(3S)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-1-ethylsulfonylpiperidine-3-carboxamide (PubChem CID 124757090) has the molecular formula C18H35N3O3S and a molecular weight of 373.56 g/mol. Its IUPAC name is (3S)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-1-ethylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-1-ethylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 124757090 |
| Molecular Formula | C18H35N3O3S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (3S)-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-1-ethylsulfonylpiperidine-3-carboxamide |
| SMILES | CC[C@H]1CCCCN1CCCNC(=O)[C@H]1CCCN(S(=O)(=O)CC)C1 |
| InChI | InChI=1S/C18H35N3O3S/c1-3-17-10-5-6-12-20(17)13-8-11-19-18(22)16-9-7-14-21(15-16)25(23,24)4-2/h16-17H,3-15H2,1-2H3,(H,19,22)/t16-,17-/m0/s1 |
| InChIKey | VNLRONMWMLTVSW-IRXDYDNUSA-N |
| XLogP | 1.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|