C15H29N3O5S — CID 52508323
tert-butyl N-[2-[[(3R)-1-ethylsulfonylpiperidine-3-carbonyl]amino]ethyl]carbamate (PubChem CID 52508323) has the molecular formula C15H29N3O5S and a molecular weight of 363.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3R)-1-ethylsulfonylpiperidine-3-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3R)-1-ethylsulfonylpiperidine-3-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 52508323 |
| Molecular Formula | C15H29N3O5S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | tert-butyl N-[2-[[(3R)-1-ethylsulfonylpiperidine-3-carbonyl]amino]ethyl]carbamate |
| SMILES | CCS(=O)(=O)N1CCC[C@@H](C(=O)NCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H29N3O5S/c1-5-24(21,22)18-10-6-7-12(11-18)13(19)16-8-9-17-14(20)23-15(2,3)4/h12H,5-11H2,1-4H3,(H,16,19)(H,17,20)/t12-/m1/s1 |
| InChIKey | NUUTVXFCKVSKPU-GFCCVEGCSA-N |
| XLogP | 0.69 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|