C18H34N4O4 — CID 48944150
tert-butyl N-[2-[[1-[2-oxo-2-(propylamino)ethyl]piperidine-3-carbonyl]amino]ethyl]carbamate (PubChem CID 48944150) has the molecular formula C18H34N4O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[2-oxo-2-(propylamino)ethyl]piperidine-3-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-[2-oxo-2-(propylamino)ethyl]piperidine-3-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 48944150 |
| Molecular Formula | C18H34N4O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | tert-butyl N-[2-[[1-[2-oxo-2-(propylamino)ethyl]piperidine-3-carbonyl]amino]ethyl]carbamate |
| SMILES | CCCNC(=O)CN1CCCC(C(=O)NCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H34N4O4/c1-5-8-19-15(23)13-22-11-6-7-14(12-22)16(24)20-9-10-21-17(25)26-18(2,3)4/h14H,5-13H2,1-4H3,(H,19,23)(H,20,24)(H,21,25) |
| InChIKey | ZREKQFYJYUJOEX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|