C23H36ClN3O3S — CID 92672052
1-[(2-chlorophenyl)methylsulfonyl]-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]piperidine-4-carboxamide (PubChem CID 92672052) has the molecular formula C23H36ClN3O3S and a molecular weight of 470.08 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylsulfonyl]-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methylsulfonyl]-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92672052 |
| Molecular Formula | C23H36ClN3O3S |
| Molecular Weight | 470.08 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 1-[(2-chlorophenyl)methylsulfonyl]-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
| SMILES | CC[C@H]1CCCCN1CCCNC(=O)C1CCN(S(=O)(=O)Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H36ClN3O3S/c1-2-21-9-5-6-14-26(21)15-7-13-25-23(28)19-11-16-27(17-12-19)31(29,30)18-20-8-3-4-10-22(20)24/h3-4,8,10,19,21H,2,5-7,9,11-18H2,1H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | CNMJNJOZVVKSNO-NRFANRHFSA-N |
| XLogP | 3.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.08 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|