C21H33ClN4O3S — CID 28574520
1-[(2-chlorophenyl)methylsulfonyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 28574520) has the molecular formula C21H33ClN4O3S and a molecular weight of 457.04 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylsulfonyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methylsulfonyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 28574520 |
| Molecular Formula | C21H33ClN4O3S |
| Molecular Weight | 457.04 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 1-[(2-chlorophenyl)methylsulfonyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)C2CCN(S(=O)(=O)Cc3ccccc3Cl)CC2)CC1 |
| InChI | InChI=1S/C21H33ClN4O3S/c1-24-13-15-25(16-14-24)10-4-9-23-21(27)18-7-11-26(12-8-18)30(28,29)17-19-5-2-3-6-20(19)22/h2-3,5-6,18H,4,7-17H2,1H3,(H,23,27) |
| InChIKey | GXPSJLRAEAYNLN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.04 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|