C22H36N4O3S — CID 99952977
1-[(3-methylphenyl)methylsulfonyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 99952977) has the molecular formula C22H36N4O3S and a molecular weight of 436.62 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methylsulfonyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-methylphenyl)methylsulfonyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 99952977 |
| Molecular Formula | C22H36N4O3S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 1-[(3-methylphenyl)methylsulfonyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCC(C(=O)NCCCN3CCN(C)CC3)CC2)c1 |
| InChI | InChI=1S/C22H36N4O3S/c1-19-5-3-6-20(17-19)18-30(28,29)26-11-7-21(8-12-26)22(27)23-9-4-10-25-15-13-24(2)14-16-25/h3,5-6,17,21H,4,7-16,18H2,1-2H3,(H,23,27) |
| InChIKey | NVSNFYLLPCCNPS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|