C23H28Cl2N2O3S — CID 92680331
1-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide (PubChem CID 92680331) has the molecular formula C23H28Cl2N2O3S and a molecular weight of 483.46 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92680331 |
| Molecular Formula | C23H28Cl2N2O3S |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(CCCNC(=O)C2CCN(S(=O)(=O)Cc3ccc(Cl)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C23H28Cl2N2O3S/c1-17-4-2-5-18(14-17)6-3-11-26-23(28)20-9-12-27(13-10-20)31(29,30)16-19-7-8-21(24)22(25)15-19/h2,4-5,7-8,14-15,20H,3,6,9-13,16H2,1H3,(H,26,28) |
| InChIKey | UYDWUQLJSQJHRY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|