C20H21Cl2NO4S — CID 2683402
(3,4-dimethylphenyl) 1-(2,3-dichlorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 2683402) has the molecular formula C20H21Cl2NO4S and a molecular weight of 442.36 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 1-(2,3-dichlorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (3,4-dimethylphenyl) 1-(2,3-dichlorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 2683402 |
| Molecular Formula | C20H21Cl2NO4S |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | (3,4-dimethylphenyl) 1-(2,3-dichlorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CCN(S(=O)(=O)c3cccc(Cl)c3Cl)CC2)cc1C |
| InChI | InChI=1S/C20H21Cl2NO4S/c1-13-6-7-16(12-14(13)2)27-20(24)15-8-10-23(11-9-15)28(25,26)18-5-3-4-17(21)19(18)22/h3-7,12,15H,8-11H2,1-2H3 |
| InChIKey | XBUHFSAJDAMELO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|